C14H23N — CID 58193774
(9aR)-8-methyl-9a-(2-methylprop-2-enyl)-1,2,3,5,6,9-hexahydropyrrolo[1,2-a]azepine (PubChem CID 58193774) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (9aR)-8-methyl-9a-(2-methylprop-2-enyl)-1,2,3,5,6,9-hexahydropyrrolo[1,2-a]azepine.
| Compound Name | (9aR)-8-methyl-9a-(2-methylprop-2-enyl)-1,2,3,5,6,9-hexahydropyrrolo[1,2-a]azepine |
|---|---|
| PubChem CID | 58193774 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (9aR)-8-methyl-9a-(2-methylprop-2-enyl)-1,2,3,5,6,9-hexahydropyrrolo[1,2-a]azepine |
| SMILES | C=C(C)C[C@@]12CCCN1CCC=C(C)C2 |
| InChI | InChI=1S/C14H23N/c1-12(2)10-14-7-5-9-15(14)8-4-6-13(3)11-14/h6H,1,4-5,7-11H2,2-3H3/t14-/m1/s1 |
| InChIKey | PXXCCTZFAKEFBT-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|