C29H40Br2O2Si — CID 58193775
3-bromo-1-[3-bromo-2-tri(propan-2-yl)silyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 58193775) has the molecular formula C29H40Br2O2Si and a molecular weight of 608.53 g/mol. Its IUPAC name is 3-bromo-1-[3-bromo-2-tri(propan-2-yl)silyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 3-bromo-1-[3-bromo-2-tri(propan-2-yl)silyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 58193775 |
| Molecular Formula | C29H40Br2O2Si |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 3-bromo-1-[3-bromo-2-tri(propan-2-yl)silyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CC(C)[Si](Oc1c(Br)cc2c(c1-c1c(O)c(Br)cc3c1CCCC3)CCCC2)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H40Br2O2Si/c1-17(2)34(18(3)4,19(5)6)33-29-25(31)16-21-12-8-10-14-23(21)27(29)26-22-13-9-7-11-20(22)15-24(30)28(26)32/h15-19,32H,7-14H2,1-6H3 |
| InChIKey | UWZSRXVZCXDTIW-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|