C50H38 — CID 58194233
10-[(3Z,7Z)-8-[2-[(1Z)-buta-1,3-dienyl]phenyl]-5,6-dimethylideneocta-1,3,7-trien-2-yl]-9-naphthalen-2-yl-2-phenylanthracene (PubChem CID 58194233) has the molecular formula C50H38 and a molecular weight of 638.85 g/mol. Its IUPAC name is 10-[(3Z,7Z)-8-[2-[(1Z)-buta-1,3-dienyl]phenyl]-5,6-dimethylideneocta-1,3,7-trien-2-yl]-9-naphthalen-2-yl-2-phenylanthracene.
| Compound Name | 10-[(3Z,7Z)-8-[2-[(1Z)-buta-1,3-dienyl]phenyl]-5,6-dimethylideneocta-1,3,7-trien-2-yl]-9-naphthalen-2-yl-2-phenylanthracene |
|---|---|
| PubChem CID | 58194233 |
| Molecular Formula | C50H38 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 10-[(3Z,7Z)-8-[2-[(1Z)-buta-1,3-dienyl]phenyl]-5,6-dimethylideneocta-1,3,7-trien-2-yl]-9-naphthalen-2-yl-2-phenylanthracene |
| SMILES | C=C/C=C\c1ccccc1/C=C\C(=C)C(=C)/C=C\C(=C)c1c2ccccc2c(-c2ccc3ccccc3c2)c2cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C50H38/c1-5-6-16-38-19-10-11-20-40(38)28-27-36(3)35(2)25-26-37(4)49-45-23-14-15-24-46(45)50(44-30-29-41-21-12-13-22-42(41)33-44)48-34-43(31-32-47(48)49)39-17-8-7-9-18-39/h5-34H,1-4H2/b16-6-,26-25-,28-27- |
| InChIKey | LXXIWHYAXHBWJF-SLNMPMNBSA-N |
| XLogP | 14.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|