C25H49N7O5 — CID 58194827
N-[(5S)-6-amino-5-methyl-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide (PubChem CID 58194827) has the molecular formula C25H49N7O5 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-methyl-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide.
| Compound Name | N-[(5S)-6-amino-5-methyl-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 58194827 |
| Molecular Formula | C25H49N7O5 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | N-[(5S)-6-amino-5-methyl-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide |
| SMILES | C/C(=N\O)C(C)(C)NCC(CNC(C)(C)/C(C)=N/O)NC(=O)CCCC(=O)NCCCC[C@H](C)C(N)=O |
| InChI | InChI=1S/C25H49N7O5/c1-17(23(26)35)11-8-9-14-27-21(33)12-10-13-22(34)30-20(15-28-24(4,5)18(2)31-36)16-29-25(6,7)19(3)32-37/h17,20,28-29,36-37H,8-16H2,1-7H3,(H2,26,35)(H,27,33)(H,30,34)/b31-18+,32-19+/t17-/m0/s1 |
| InChIKey | IIGYLLPOVOHLGQ-IYOZERNBSA-N |
| XLogP | 1.49 |
| TPSA | 190.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|