C20H35F9N2O4+2 — CID 58194899
1-[4-[3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-3-(2,2,3-trifluoropropoxy)propan-2-ol (PubChem CID 58194899) has the molecular formula C20H35F9N2O4+2 and a molecular weight of 538.49 g/mol. Its IUPAC name is 1-[4-[3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-3-(2,2,3-trifluoropropoxy)propan-2-ol.
| Compound Name | 1-[4-[3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-3-(2,2,3-trifluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 58194899 |
| Molecular Formula | C20H35F9N2O4+2 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 1-[4-[3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-3-(2,2,3-trifluoropropoxy)propan-2-ol |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)COCC(O)C[N+]1(C)CC[N+](C)(CC(O)COCC(F)(F)CF)CC1 |
| InChI | InChI=1S/C20H35F9N2O4/c1-17(22,23)20(28,29)19(26,27)14-35-11-16(33)9-31(3)6-4-30(2,5-7-31)8-15(32)10-34-13-18(24,25)12-21/h15-16,32-33H,4-14H2,1-3H3/q+2 |
| InChIKey | ZBBBLMAEGNISLK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|