C20H37F9N2O4+2 — CID 58194901
[3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-[2-[[2-hydroxy-3-(2,2,3-trifluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium (PubChem CID 58194901) has the molecular formula C20H37F9N2O4+2 and a molecular weight of 540.51 g/mol. Its IUPAC name is [3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-[2-[[2-hydroxy-3-(2,2,3-trifluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium.
| Compound Name | [3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-[2-[[2-hydroxy-3-(2,2,3-trifluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58194901 |
| Molecular Formula | C20H37F9N2O4+2 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | [3-(2,2,3,3,4,4-hexafluoropentoxy)-2-hydroxypropyl]-[2-[[2-hydroxy-3-(2,2,3-trifluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)COCC(O)C[N+](C)(C)CC[N+](C)(C)CC(O)COCC(F)(F)CF |
| InChI | InChI=1S/C20H37F9N2O4/c1-17(22,23)20(28,29)19(26,27)14-35-11-16(33)9-31(4,5)7-6-30(2,3)8-15(32)10-34-13-18(24,25)12-21/h15-16,32-33H,6-14H2,1-5H3/q+2 |
| InChIKey | KKPUMPDUTAYRDT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|