C18H34F8N2O4+2 — CID 58194902
[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium (PubChem CID 58194902) has the molecular formula C18H34F8N2O4+2 and a molecular weight of 494.46 g/mol. Its IUPAC name is [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium.
| Compound Name | [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58194902 |
| Molecular Formula | C18H34F8N2O4+2 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-dimethylazaniumyl]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CC[N+](C)(C)CC(O)COCC(F)(F)C(F)F)CC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C18H34F8N2O4/c1-27(2,7-13(29)9-31-11-17(23,24)15(19)20)5-6-28(3,4)8-14(30)10-32-12-18(25,26)16(21)22/h13-16,29-30H,5-12H2,1-4H3/q+2 |
| InChIKey | USDZHHUYKBRDTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|