C11H22F4NO2+ — CID 58194905
triethyl-[2-hydroxy-3-(1,1,2,2-tetrafluoroethoxy)propyl]azanium (PubChem CID 58194905) has the molecular formula C11H22F4NO2+ and a molecular weight of 276.29 g/mol. Its IUPAC name is triethyl-[2-hydroxy-3-(1,1,2,2-tetrafluoroethoxy)propyl]azanium.
| Compound Name | triethyl-[2-hydroxy-3-(1,1,2,2-tetrafluoroethoxy)propyl]azanium |
|---|---|
| PubChem CID | 58194905 |
| Molecular Formula | C11H22F4NO2+ |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | triethyl-[2-hydroxy-3-(1,1,2,2-tetrafluoroethoxy)propyl]azanium |
| SMILES | CC[N+](CC)(CC)CC(O)COC(F)(F)C(F)F |
| InChI | InChI=1S/C11H22F4NO2/c1-4-16(5-2,6-3)7-9(17)8-18-11(14,15)10(12)13/h9-10,17H,4-8H2,1-3H3/q+1 |
| InChIKey | WKWZVPZYWOSAQM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|