C14H24F8NO5+ — CID 58194906
tris(2-hydroxyethyl)-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]azanium (PubChem CID 58194906) has the molecular formula C14H24F8NO5+ and a molecular weight of 438.33 g/mol. Its IUPAC name is tris(2-hydroxyethyl)-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]azanium.
| Compound Name | tris(2-hydroxyethyl)-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]azanium |
|---|---|
| PubChem CID | 58194906 |
| Molecular Formula | C14H24F8NO5+ |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | tris(2-hydroxyethyl)-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]azanium |
| SMILES | OCC[N+](CCO)(CCO)CC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H24F8NO5/c15-11(16)13(19,20)14(21,22)12(17,18)9-28-8-10(27)7-23(1-4-24,2-5-25)3-6-26/h10-11,24-27H,1-9H2/q+1 |
| InChIKey | JYGJZIRNKROWRE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|