C12H26F2NO2+ — CID 58194912
[3-(3,3-difluoropropoxy)-2-hydroxypropyl]-triethylazanium (PubChem CID 58194912) has the molecular formula C12H26F2NO2+ and a molecular weight of 254.34 g/mol. Its IUPAC name is [3-(3,3-difluoropropoxy)-2-hydroxypropyl]-triethylazanium.
| Compound Name | [3-(3,3-difluoropropoxy)-2-hydroxypropyl]-triethylazanium |
|---|---|
| PubChem CID | 58194912 |
| Molecular Formula | C12H26F2NO2+ |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [3-(3,3-difluoropropoxy)-2-hydroxypropyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(O)COCCC(F)F |
| InChI | InChI=1S/C12H26F2NO2/c1-4-15(5-2,6-3)9-11(16)10-17-8-7-12(13)14/h11-12,16H,4-10H2,1-3H3/q+1 |
| InChIKey | CEUDRJWSXVZAGS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|