C12H15FN4O3 — CID 58195120
(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 58195120) has the molecular formula C12H15FN4O3 and a molecular weight of 282.28 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58195120 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](CO)O[C@H]1c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C12H15FN4O3/c1-12(13)9(19)8(4-18)20-10(12)6-2-3-7-11(14)15-5-16-17(6)7/h2-3,5,8-10,18-19H,4H2,1H3,(H2,14,15,16)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | WFPQBZHJVRZUIC-MWGHHZFTSA-N |
| XLogP | -0.17 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |