C29H48N2O5 — CID 58195240
(1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one (PubChem CID 58195240) has the molecular formula C29H48N2O5 and a molecular weight of 504.71 g/mol. Its IUPAC name is (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one.
| Compound Name | (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one |
|---|---|
| PubChem CID | 58195240 |
| Molecular Formula | C29H48N2O5 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one |
| SMILES | CC[C@H](C)[C@H](NC)[C@@H](CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)C[C@H](C)[C@@H](O)c1ccccc1)OC |
| InChI | InChI=1S/C29H48N2O5/c1-8-19(2)27(30-5)25(35-6)18-26(33)31-16-12-15-23(31)29(36-7)21(4)24(32)17-20(3)28(34)22-13-10-9-11-14-22/h9-11,13-14,19-21,23,25,27-30,34H,8,12,15-18H2,1-7H3/t19-,20-,21-,23-,25+,27-,28+,29+/m0/s1 |
| InChIKey | USXUNAFCUVHBPY-FXCRKWJXSA-N |
| XLogP | 4.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |