C17H15FN2O2 — CID 58195290
3-[(4-fluorophenyl)methoxy]-5-(2-methoxyphenyl)-1H-pyrazole (PubChem CID 58195290) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-5-(2-methoxyphenyl)-1H-pyrazole.
| Compound Name | 3-[(4-fluorophenyl)methoxy]-5-(2-methoxyphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 58195290 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-5-(2-methoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccccc1-c1cc(OCc2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C17H15FN2O2/c1-21-16-5-3-2-4-14(16)15-10-17(20-19-15)22-11-12-6-8-13(18)9-7-12/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | ZWFXXEZJMYTULD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |