About 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol
4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol (PubChem CID 58195628) has the molecular formula C8H12F6O5S2
and a molecular weight of 366.30 g/mol. Its IUPAC name is 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol.
Molecular Properties
| Compound Name | 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol |
| PubChem CID | 58195628 |
| Molecular Formula | C8H12F6O5S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol |
| SMILES | CC(C)C(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O5S2/c1-4(2)5(15)3-6(20(16,17)7(9,10)11)21(18,19)8(12,13)14/h4-6,15H,3H2,1-2H3 |
| InChIKey | HRMQTADSPOONQV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol?
The IUPAC name of 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol (CID 58195628) is 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol.
What is the SMILES notation for 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol?
The canonical SMILES for 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol is CC(C)C(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol?
The InChIKey is HRMQTADSPOONQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F6O5S2/c1-4(2)5(15)3-6(20(16,17)7(9,10)11)21(18,19)8(12,13)14/h4-6,15H,3H2,1-2H3.
What are the key properties of 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol?
4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol has a molecular weight of 366.30 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-ol is sourced from PubChem (CID 58195628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).