About 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea
1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea (PubChem CID 58195669) has the molecular formula C9H14F6N2O5S2
and a molecular weight of 408.34 g/mol. Its IUPAC name is 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea |
| PubChem CID | 58195669 |
| Molecular Formula | C9H14F6N2O5S2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)NC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H14F6N2O5S2/c1-3-16-7(18)17-5(2)4-6(23(19,20)8(10,11)12)24(21,22)9(13,14)15/h5-6H,3-4H2,1-2H3,(H2,16,17,18) |
| InChIKey | UQGILVNZBHGZCX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea?
The IUPAC name of 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea (CID 58195669) is 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea.
What is the SMILES notation for 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea?
The canonical SMILES for 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea is CCNC(=O)NC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea?
The InChIKey is UQGILVNZBHGZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F6N2O5S2/c1-3-16-7(18)17-5(2)4-6(23(19,20)8(10,11)12)24(21,22)9(13,14)15/h5-6H,3-4H2,1-2H3,(H2,16,17,18).
What are the key properties of 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea?
1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea has a molecular weight of 408.34 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-ethylurea is sourced from PubChem (CID 58195669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).