About 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate
4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate (PubChem CID 58195676) has the molecular formula C17H22F6NO6S2-
and a molecular weight of 514.49 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate.
Molecular Properties
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate |
| PubChem CID | 58195676 |
| Molecular Formula | C17H22F6NO6S2- |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate |
| SMILES | CC(C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22F6NO6S2/c1-9(2-13(31(26,27)16(18,19)20)32(28,29)17(21,22)23)30-14(25)24-15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,2-8H2,1H3,(H,24,25)/q-1 |
| InChIKey | NSLBKMFNOAKJHD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate?
The IUPAC name of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate (CID 58195676) is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate.
What is the SMILES notation for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate?
The canonical SMILES for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate is CC(C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate?
The InChIKey is NSLBKMFNOAKJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F6NO6S2/c1-9(2-13(31(26,27)16(18,19)20)32(28,29)17(21,22)23)30-14(25)24-15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,2-8H2,1H3,(H,24,25)/q-1.
What are the key properties of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate?
4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate has a molecular weight of 514.49 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl N-(1-adamantyl)carbamate is sourced from PubChem (CID 58195676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).