C10H9F12O7S3- — CID 58195759
4,4-bis(trifluoromethylsulfonyl)butan-2-yl 1,1,2,2,3,3-hexafluorobutane-1-sulfonate (PubChem CID 58195759) has the molecular formula C10H9F12O7S3- and a molecular weight of 565.35 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 1,1,2,2,3,3-hexafluorobutane-1-sulfonate.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 58195759 |
| Molecular Formula | C10H9F12O7S3- |
| Molecular Weight | 565.35 g/mol |
| Exact Mass | 564.93 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
| SMILES | CC(C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C10H9F12O7S3/c1-4(29-32(27,28)8(15,16)7(13,14)6(2,11)12)3-5(30(23,24)9(17,18)19)31(25,26)10(20,21)22/h4H,3H2,1-2H3/q-1 |
| InChIKey | GDVQWVIWVXLFHN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|