About 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol
2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol (PubChem CID 58195769) has the molecular formula C9H14F6O5S2
and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol.
Molecular Properties
| Compound Name | 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol |
| PubChem CID | 58195769 |
| Molecular Formula | C9H14F6O5S2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol |
| SMILES | CCCC(CO)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O5S2/c1-2-3-6(5-16)4-7(21(17,18)8(10,11)12)22(19,20)9(13,14)15/h6-7,16H,2-5H2,1H3 |
| InChIKey | ARXBTLWIGWTXMG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol?
The IUPAC name of 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol (CID 58195769) is 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol.
What is the SMILES notation for 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol?
The canonical SMILES for 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol is CCCC(CO)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol?
The InChIKey is ARXBTLWIGWTXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F6O5S2/c1-2-3-6(5-16)4-7(21(17,18)8(10,11)12)22(19,20)9(13,14)15/h6-7,16H,2-5H2,1H3.
What are the key properties of 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol?
2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol has a molecular weight of 380.33 g/mol, XLogP of 1.98, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis(trifluoromethylsulfonyl)ethyl]pentan-1-ol is sourced from PubChem (CID 58195769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).