About methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate
methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate (PubChem CID 58196002) has the molecular formula C16H29FO3
and a molecular weight of 288.40 g/mol. Its IUPAC name is methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate.
Molecular Properties
| Compound Name | methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate |
| PubChem CID | 58196002 |
| Molecular Formula | C16H29FO3 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate |
| SMILES | C=C(C(C)(C)C)C(O)(CCCC(C)(C)F)CC(=O)OC |
| InChI | InChI=1S/C16H29FO3/c1-12(14(2,3)4)16(19,11-13(18)20-7)10-8-9-15(5,6)17/h19H,1,8-11H2,2-7H3 |
| InChIKey | OEZCOZRWHMQMQK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate?
The IUPAC name of methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate (CID 58196002) is methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate.
What is the SMILES notation for methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate?
The canonical SMILES for methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate is C=C(C(C)(C)C)C(O)(CCCC(C)(C)F)CC(=O)OC.
What is the InChIKey of methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate?
The InChIKey is OEZCOZRWHMQMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29FO3/c1-12(14(2,3)4)16(19,11-13(18)20-7)10-8-9-15(5,6)17/h19H,1,8-11H2,2-7H3.
What are the key properties of methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate?
methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate has a molecular weight of 288.40 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,3-dimethylbut-1-en-2-yl)-7-fluoro-3-hydroxy-7-methyloctanoate is sourced from PubChem (CID 58196002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).