C13H20IN — CID 58196047
8-[(Z)-2-iodobut-1-enyl]-6,7-dimethyl-1,2,3,5-tetrahydropyrrolizine (PubChem CID 58196047) has the molecular formula C13H20IN and a molecular weight of 317.21 g/mol. Its IUPAC name is 8-[(Z)-2-iodobut-1-enyl]-6,7-dimethyl-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | 8-[(Z)-2-iodobut-1-enyl]-6,7-dimethyl-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 58196047 |
| Molecular Formula | C13H20IN |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 8-[(Z)-2-iodobut-1-enyl]-6,7-dimethyl-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CC/C(I)=C/C12CCCN1CC(C)=C2C |
| InChI | InChI=1S/C13H20IN/c1-4-12(14)8-13-6-5-7-15(13)9-10(2)11(13)3/h8H,4-7,9H2,1-3H3/b12-8- |
| InChIKey | QJCGBYUVSSJDJB-WQLSENKSSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|