C22H29F3N2O8 — CID 58196329
(2S)-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]-3-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 58196329) has the molecular formula C22H29F3N2O8 and a molecular weight of 506.47 g/mol. Its IUPAC name is (2S)-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]-3-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | (2S)-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]-3-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 58196329 |
| Molecular Formula | C22H29F3N2O8 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (2S)-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]-3-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(OCc1ccccc1)[C@H](NC(=O)C(F)(F)F)C(=O)NCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C22H29F3N2O8/c1-12(34-11-13-6-3-2-4-7-13)15(27-21(31)22(23,24)25)19(30)26-10-14-18-16(28)17(29)20(35-14)33-9-5-8-32-18/h2-4,6-7,12,14-18,20,28-29H,5,8-11H2,1H3,(H,26,30)(H,27,31)/t12?,14?,15-,16?,17?,18?,20?/m0/s1 |
| InChIKey | UPVNBIHYCFNRSH-XUDBHECTSA-N |
| XLogP | 0.01 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |