C20H24N6O3 — CID 58196386
(3E)-3-[[7-(cyclopropylmethylamino)-5-(1,4-oxazepan-4-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196386) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylmethylamino)-5-(1,4-oxazepan-4-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylmethylamino)-5-(1,4-oxazepan-4-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196386 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylmethylamino)-5-(1,4-oxazepan-4-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC4CC4)cc(N4CCCOCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H24N6O3/c27-18-9-14(20(28)24-18)8-15-12-22-26-16(21-11-13-2-3-13)10-17(23-19(15)26)25-4-1-6-29-7-5-25/h8,10,12-13,21H,1-7,9,11H2,(H,24,27,28)/b14-8+ |
| InChIKey | ACWVMLHPICDZDL-RIYZIHGNSA-N |
| XLogP | 1.21 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|