C22H21N5O4S — CID 58196400
(3E)-3-[[8-(cyclopropylamino)-6-[3-(methylsulfonylmethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196400) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is (3E)-3-[[8-(cyclopropylamino)-6-[3-(methylsulfonylmethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[8-(cyclopropylamino)-6-[3-(methylsulfonylmethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196400 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (3E)-3-[[8-(cyclopropylamino)-6-[3-(methylsulfonylmethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)Cc1cccc(-c2cc(NC3CC3)c3ncc(/C=C4\CC(=O)NC4=O)n3n2)c1 |
| InChI | InChI=1S/C22H21N5O4S/c1-32(30,31)12-13-3-2-4-14(7-13)18-10-19(24-16-5-6-16)21-23-11-17(27(21)26-18)8-15-9-20(28)25-22(15)29/h2-4,7-8,10-11,16,24H,5-6,9,12H2,1H3,(H,25,28,29)/b15-8+ |
| InChIKey | JNPKGZLMGWZVGR-OVCLIPMQSA-N |
| XLogP | 1.95 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|