C24H26FN7O3 — CID 58196458
(3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196458) has the molecular formula C24H26FN7O3 and a molecular weight of 479.52 g/mol. Its IUPAC name is (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196458 |
| Molecular Formula | C24H26FN7O3 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCCc4cccc(F)c4)nc(NC4CCC(O)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C24H26FN7O3/c25-17-3-1-2-14(10-17)8-9-26-24-31-23(28-18-4-6-19(33)7-5-18)30-21-16(13-27-32(21)24)11-15-12-20(34)29-22(15)35/h1-3,10-11,13,18-19,33H,4-9,12H2,(H,29,34,35)(H2,26,28,30,31)/b15-11+ |
| InChIKey | GIXBQNVAVTYKGI-RVDMUPIBSA-N |
| XLogP | 2.06 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|