C15H14ClN5O2 — CID 58196565
(3E)-3-[[5-chloro-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196565) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is (3E)-3-[[5-chloro-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[5-chloro-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196565 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (3E)-3-[[5-chloro-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC4CC4)cc(Cl)nc23)C(=O)N1 |
| InChI | InChI=1S/C15H14ClN5O2/c16-11-5-12(17-6-8-1-2-8)21-14(19-11)10(7-18-21)3-9-4-13(22)20-15(9)23/h3,5,7-8,17H,1-2,4,6H2,(H,20,22,23)/b9-3+ |
| InChIKey | XWKONBZXDWZSIS-YCRREMRBSA-N |
| XLogP | 1.63 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|