C27H26N8O3 — CID 58196581
(3E)-3-[[4-anilino-2-[[morpholin-4-yl(phenyl)methyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196581) has the molecular formula C27H26N8O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is (3E)-3-[[4-anilino-2-[[morpholin-4-yl(phenyl)methyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-anilino-2-[[morpholin-4-yl(phenyl)methyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196581 |
| Molecular Formula | C27H26N8O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (3E)-3-[[4-anilino-2-[[morpholin-4-yl(phenyl)methyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(Nc4ccccc4)nc(NC(c4ccccc4)N4CCOCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C27H26N8O3/c36-22-16-19(25(37)30-22)15-20-17-28-35-24(20)32-26(33-27(35)29-21-9-5-2-6-10-21)31-23(18-7-3-1-4-8-18)34-11-13-38-14-12-34/h1-10,15,17,23H,11-14,16H2,(H,30,36,37)(H2,29,31,32,33)/b19-15+ |
| InChIKey | USNYFVWSWHWYCK-XDJHFCHBSA-N |
| XLogP | 2.74 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|