C21H17F3N6O3 — CID 58196583
(3E)-3-[[7-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196583) has the molecular formula C21H17F3N6O3 and a molecular weight of 458.40 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196583 |
| Molecular Formula | C21H17F3N6O3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(Nc4cccc(OC(F)(F)F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C21H17F3N6O3/c22-21(23,24)33-15-3-1-2-14(8-15)26-16-9-17(27-13-4-5-13)30-19(28-16)12(10-25-30)6-11-7-18(31)29-20(11)32/h1-3,6,8-10,13,27H,4-5,7H2,(H,26,28)(H,29,31,32)/b11-6+ |
| InChIKey | LGCQRBVOFWZCOC-IZZDOVSWSA-N |
| XLogP | 3.38 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|