C22H20FN5O2 — CID 58196633
(3E)-3-[[7-(cyclopropylamino)-5-[(4-fluoro-3-methylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196633) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[(4-fluoro-3-methylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[(4-fluoro-3-methylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196633 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[(4-fluoro-3-methylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(Cc2cc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)ccc1F |
| InChI | InChI=1S/C22H20FN5O2/c1-12-6-13(2-5-18(12)23)7-17-10-19(25-16-3-4-16)28-21(26-17)15(11-24-28)8-14-9-20(29)27-22(14)30/h2,5-6,8,10-11,16,25H,3-4,7,9H2,1H3,(H,27,29,30)/b14-8+ |
| InChIKey | BLJFXYKBVYJZGJ-RIYZIHGNSA-N |
| XLogP | 2.77 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|