C18H23N7O3 — CID 58196648
(3E)-3-[[2-[[(1S)-1-cyclopropylethyl]amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196648) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is (3E)-3-[[2-[[(1S)-1-cyclopropylethyl]amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-[[(1S)-1-cyclopropylethyl]amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196648 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3E)-3-[[2-[[(1S)-1-cyclopropylethyl]amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COCCNc1nc(N[C@@H](C)C2CC2)nc2c(/C=C3\CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C18H23N7O3/c1-10(11-3-4-11)21-17-23-15-13(7-12-8-14(26)22-16(12)27)9-20-25(15)18(24-17)19-5-6-28-2/h7,9-11H,3-6,8H2,1-2H3,(H,22,26,27)(H2,19,21,23,24)/b12-7+/t10-/m0/s1 |
| InChIKey | CDUVQSVVSMHXAT-QVIVLVACSA-N |
| XLogP | 0.82 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|