C26H24FN7O2 — CID 58196664
(3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-(1-phenylethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196664) has the molecular formula C26H24FN7O2 and a molecular weight of 485.52 g/mol. Its IUPAC name is (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-(1-phenylethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-(1-phenylethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196664 |
| Molecular Formula | C26H24FN7O2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (3E)-3-[[4-[2-(3-fluorophenyl)ethylamino]-2-(1-phenylethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CC(Nc1nc(NCCc2cccc(F)c2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1)c1ccccc1 |
| InChI | InChI=1S/C26H24FN7O2/c1-16(18-7-3-2-4-8-18)30-25-32-23-20(13-19-14-22(35)31-24(19)36)15-29-34(23)26(33-25)28-11-10-17-6-5-9-21(27)12-17/h2-9,12-13,15-16H,10-11,14H2,1H3,(H,31,35,36)(H2,28,30,32,33)/b19-13+ |
| InChIKey | FOXLLQFXIOUVJL-CPNJWEJPSA-N |
| XLogP | 3.52 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|