C23H26N8O2 — CID 58196703
(3E)-3-[[4-anilino-2-(3-pyrrolidin-1-ylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196703) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is (3E)-3-[[4-anilino-2-(3-pyrrolidin-1-ylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-anilino-2-(3-pyrrolidin-1-ylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196703 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (3E)-3-[[4-anilino-2-(3-pyrrolidin-1-ylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(Nc4ccccc4)nc(NCCCN4CCCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C23H26N8O2/c32-19-14-16(21(33)27-19)13-17-15-25-31-20(17)28-22(24-9-6-12-30-10-4-5-11-30)29-23(31)26-18-7-2-1-3-8-18/h1-3,7-8,13,15H,4-6,9-12,14H2,(H,27,32,33)(H2,24,26,28,29)/b16-13+ |
| InChIKey | GZTRSOAFRHLJSX-DTQAZKPQSA-N |
| XLogP | 2.20 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|