C22H21FN6O2 — CID 58196708
(3E)-3-[[7-(cyclopropylamino)-5-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196708) has the molecular formula C22H21FN6O2 and a molecular weight of 420.45 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196708 |
| Molecular Formula | C22H21FN6O2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | C[C@H](Nc1cc(NC2CC2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN6O2/c1-12(13-2-4-16(23)5-3-13)25-18-10-19(26-17-6-7-17)29-21(27-18)15(11-24-29)8-14-9-20(30)28-22(14)31/h2-5,8,10-12,17,26H,6-7,9H2,1H3,(H,25,27)(H,28,30,31)/b14-8+/t12-/m0/s1 |
| InChIKey | WLLRHNQHKZCCRP-ACLQVGRQSA-N |
| XLogP | 3.05 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|