C19H22FN7O3 — CID 58196755
(3E)-3-[[4-(3-fluoropyrrolidin-1-yl)-2-(oxan-4-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196755) has the molecular formula C19H22FN7O3 and a molecular weight of 415.43 g/mol. Its IUPAC name is (3E)-3-[[4-(3-fluoropyrrolidin-1-yl)-2-(oxan-4-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(3-fluoropyrrolidin-1-yl)-2-(oxan-4-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196755 |
| Molecular Formula | C19H22FN7O3 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (3E)-3-[[4-(3-fluoropyrrolidin-1-yl)-2-(oxan-4-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(N4CCC(F)C4)nc(NC4CCOCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H22FN7O3/c20-13-1-4-26(10-13)19-25-18(22-14-2-5-30-6-3-14)24-16-12(9-21-27(16)19)7-11-8-15(28)23-17(11)29/h7,9,13-14H,1-6,8,10H2,(H,22,24)(H,23,28,29)/b11-7+ |
| InChIKey | GBPFCYYAISCANI-YRNVUSSQSA-N |
| XLogP | 0.69 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|