C14H16N6O5S — CID 58196766
(3E)-3-[[4-(2-methoxyethylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196766) has the molecular formula C14H16N6O5S and a molecular weight of 380.39 g/mol. Its IUPAC name is (3E)-3-[[4-(2-methoxyethylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(2-methoxyethylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196766 |
| Molecular Formula | C14H16N6O5S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (3E)-3-[[4-(2-methoxyethylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COCCNc1nc(S(C)(=O)=O)nc2c(/C=C3\CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C14H16N6O5S/c1-25-4-3-15-13-19-14(26(2,23)24)18-11-9(7-16-20(11)13)5-8-6-10(21)17-12(8)22/h5,7H,3-4,6H2,1-2H3,(H,15,18,19)(H,17,21,22)/b8-5+ |
| InChIKey | QXJVGUMZQFTPJN-VMPITWQZSA-N |
| XLogP | -0.98 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|