C22H19ClFN5O2 — CID 58196802
(3E)-3-[[5-[(2-chloro-4-fluoro-5-methylphenyl)methyl]-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196802) has the molecular formula C22H19ClFN5O2 and a molecular weight of 439.88 g/mol. Its IUPAC name is (3E)-3-[[5-[(2-chloro-4-fluoro-5-methylphenyl)methyl]-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[5-[(2-chloro-4-fluoro-5-methylphenyl)methyl]-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196802 |
| Molecular Formula | C22H19ClFN5O2 |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (3E)-3-[[5-[(2-chloro-4-fluoro-5-methylphenyl)methyl]-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(Cc2cc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c(Cl)cc1F |
| InChI | InChI=1S/C22H19ClFN5O2/c1-11-4-12(17(23)9-18(11)24)6-16-8-19(26-15-2-3-15)29-21(27-16)14(10-25-29)5-13-7-20(30)28-22(13)31/h4-5,8-10,15,26H,2-3,6-7H2,1H3,(H,28,30,31)/b13-5+ |
| InChIKey | WEJJZQSEKGRZDA-WLRTZDKTSA-N |
| XLogP | 3.43 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|