C19H18N6O2S — CID 58196831
(3E)-3-[[7-(cyclopropylamino)-5-(thiophen-2-ylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196831) has the molecular formula C19H18N6O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-(thiophen-2-ylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-(thiophen-2-ylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196831 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-(thiophen-2-ylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(NCc4cccs4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H18N6O2S/c26-17-7-11(19(27)24-17)6-12-9-21-25-16(22-13-3-4-13)8-15(23-18(12)25)20-10-14-2-1-5-28-14/h1-2,5-6,8-9,13,22H,3-4,7,10H2,(H,20,23)(H,24,26,27)/b11-6+ |
| InChIKey | PZECUUHNTYMRJJ-IZZDOVSWSA-N |
| XLogP | 2.41 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|