C16H18FN7O2 — CID 58196872
(3E)-3-[[2-(dimethylamino)-4-(3-fluoropyrrolidin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58196872) has the molecular formula C16H18FN7O2 and a molecular weight of 359.37 g/mol. Its IUPAC name is (3E)-3-[[2-(dimethylamino)-4-(3-fluoropyrrolidin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-(dimethylamino)-4-(3-fluoropyrrolidin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58196872 |
| Molecular Formula | C16H18FN7O2 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3E)-3-[[2-(dimethylamino)-4-(3-fluoropyrrolidin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CN(C)c1nc(N2CCC(F)C2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C16H18FN7O2/c1-22(2)15-20-13-10(5-9-6-12(25)19-14(9)26)7-18-24(13)16(21-15)23-4-3-11(17)8-23/h5,7,11H,3-4,6,8H2,1-2H3,(H,19,25,26)/b9-5+ |
| InChIKey | JRGDHZPAAZEXKP-WEVVVXLNSA-N |
| XLogP | 0.17 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|