About CID 58196981
CID 58196981 (PubChem CID 58196981) has the molecular formula C24H34N2O3S
and a molecular weight of 430.61 g/mol.
Molecular Properties
| Compound Name | CID 58196981 |
| PubChem CID | 58196981 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(OCC(C)C)cc1C21NC(=S)N(C(C)C)C1=O |
| InChI | InChI=1S/C24H34N2O3S/c1-15(2)14-29-19-7-6-17-13-23(10-8-18(28-5)9-11-23)24(20(17)12-19)21(27)26(16(3)4)22(30)25-24/h6-7,12,15-16,18H,8-11,13-14H2,1-5H3,(H,25,30) |
| InChIKey | RTAGMEYLDHTUKR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 58196981 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58196981?
The IUPAC name of CID 58196981 (CID 58196981) is not available.
What is the SMILES notation for CID 58196981?
The canonical SMILES for CID 58196981 is COC1CCC2(CC1)Cc1ccc(OCC(C)C)cc1C21NC(=S)N(C(C)C)C1=O.
What is the InChIKey of CID 58196981?
The InChIKey is RTAGMEYLDHTUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O3S/c1-15(2)14-29-19-7-6-17-13-23(10-8-18(28-5)9-11-23)24(20(17)12-19)21(27)26(16(3)4)22(30)25-24/h6-7,12,15-16,18H,8-11,13-14H2,1-5H3,(H,25,30).
What are the key properties of CID 58196981?
CID 58196981 has a molecular weight of 430.61 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58196981 is sourced from PubChem (CID 58196981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).