About (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide
(6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (PubChem CID 58196997) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
Molecular Properties
| Compound Name | (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| PubChem CID | 58196997 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| SMILES | COC1CCC2(CC1)Cc1ccc(C3CCCC3)cc1/C2=N\C#N |
| InChI | InChI=1S/C21H26N2O/c1-24-18-8-10-21(11-9-18)13-17-7-6-16(15-4-2-3-5-15)12-19(17)20(21)23-14-22/h6-7,12,15,18H,2-5,8-11,13H2,1H3/b23-20+ |
| InChIKey | NDBGNDSSHKOPPG-BSYVCWPDSA-N |
| XLogP | 4.75 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The IUPAC name of (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (CID 58196997) is (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
What is the SMILES notation for (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The canonical SMILES for (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is COC1CCC2(CC1)Cc1ccc(C3CCCC3)cc1/C2=N\C#N.
What is the InChIKey of (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The InChIKey is NDBGNDSSHKOPPG-BSYVCWPDSA-N. The full InChI is InChI=1S/C21H26N2O/c1-24-18-8-10-21(11-9-18)13-17-7-6-16(15-4-2-3-5-15)12-19(17)20(21)23-14-22/h6-7,12,15,18H,2-5,8-11,13H2,1H3/b23-20+.
What are the key properties of (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
(6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide has a molecular weight of 322.45 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyclopentyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is sourced from PubChem (CID 58196997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).