About [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide
[6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide (PubChem CID 58197017) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide.
Molecular Properties
| Compound Name | [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide |
| PubChem CID | 58197017 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide |
| SMILES | CCOCCCc1ccc2c(c1)/C(=N\C#N)C1(CCC(OC)CC1)C2 |
| InChI | InChI=1S/C21H28N2O2/c1-3-25-12-4-5-16-6-7-17-14-21(10-8-18(24-2)9-11-21)20(23-15-22)19(17)13-16/h6-7,13,18H,3-5,8-12,14H2,1-2H3/b23-20+ |
| InChIKey | MYHQTBBLKJWOHE-BSYVCWPDSA-N |
| XLogP | 4.06 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The IUPAC name of [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide (CID 58197017) is [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide.
What is the SMILES notation for [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The canonical SMILES for [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide is CCOCCCc1ccc2c(c1)/C(=N\C#N)C1(CCC(OC)CC1)C2.
What is the InChIKey of [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The InChIKey is MYHQTBBLKJWOHE-BSYVCWPDSA-N. The full InChI is InChI=1S/C21H28N2O2/c1-3-25-12-4-5-16-6-7-17-14-21(10-8-18(24-2)9-11-21)20(23-15-22)19(17)13-16/h6-7,13,18H,3-5,8-12,14H2,1-2H3/b23-20+.
What are the key properties of [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
[6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide has a molecular weight of 340.47 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3-ethoxypropyl)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide is sourced from PubChem (CID 58197017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).