About US9212153, 521a,Ex. 415
US9212153, 521a,Ex. 415 (PubChem CID 58197024) has the molecular formula C22H26N4O2S
and a molecular weight of 410.54 g/mol.
Molecular Properties
| Compound Name | US9212153, 521a,Ex. 415 |
| PubChem CID | 58197024 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cnc(C)s3)cc1C21N=C(N)N(C)C1=O |
| InChI | InChI=1S/C22H26N4O2S/c1-13-24-12-18(29-13)14-4-5-15-11-21(8-6-16(28-3)7-9-21)22(17(15)10-14)19(27)26(2)20(23)25-22/h4-5,10,12,16H,6-9,11H2,1-3H3,(H2,23,25) |
| InChIKey | RAMQFWJJXZGADF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US9212153, 521a,Ex. 415 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US9212153, 521a,Ex. 415?
The IUPAC name of US9212153, 521a,Ex. 415 (CID 58197024) is not available.
What is the SMILES notation for US9212153, 521a,Ex. 415?
The canonical SMILES for US9212153, 521a,Ex. 415 is COC1CCC2(CC1)Cc1ccc(-c3cnc(C)s3)cc1C21N=C(N)N(C)C1=O.
What is the InChIKey of US9212153, 521a,Ex. 415?
The InChIKey is RAMQFWJJXZGADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2S/c1-13-24-12-18(29-13)14-4-5-15-11-21(8-6-16(28-3)7-9-21)22(17(15)10-14)19(27)26(2)20(23)25-22/h4-5,10,12,16H,6-9,11H2,1-3H3,(H2,23,25).
What are the key properties of US9212153, 521a,Ex. 415?
US9212153, 521a,Ex. 415 has a molecular weight of 410.54 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US9212153, 521a,Ex. 415 is sourced from PubChem (CID 58197024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).