About CID 58197025
CID 58197025 (PubChem CID 58197025) has the molecular formula C25H23ClN4O2
and a molecular weight of 446.94 g/mol.
Molecular Properties
| Compound Name | CID 58197025 |
| PubChem CID | 58197025 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | — |
| SMILES | Cc1onc2c1CC1(CC2)Cc2ccc(-c3cccc(Cl)c3)cc2C12N=C(N)N(C)C2=O |
| InChI | InChI=1S/C25H23ClN4O2/c1-14-19-13-24(9-8-21(19)29-32-14)12-17-7-6-16(15-4-3-5-18(26)10-15)11-20(17)25(24)22(31)30(2)23(27)28-25/h3-7,10-11H,8-9,12-13H2,1-2H3,(H2,27,28) |
| InChIKey | GLRDCLJMIBECEN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 58197025 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58197025?
The IUPAC name of CID 58197025 (CID 58197025) is not available.
What is the SMILES notation for CID 58197025?
The canonical SMILES for CID 58197025 is Cc1onc2c1CC1(CC2)Cc2ccc(-c3cccc(Cl)c3)cc2C12N=C(N)N(C)C2=O.
What is the InChIKey of CID 58197025?
The InChIKey is GLRDCLJMIBECEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23ClN4O2/c1-14-19-13-24(9-8-21(19)29-32-14)12-17-7-6-16(15-4-3-5-18(26)10-15)11-20(17)25(24)22(31)30(2)23(27)28-25/h3-7,10-11H,8-9,12-13H2,1-2H3,(H2,27,28).
What are the key properties of CID 58197025?
CID 58197025 has a molecular weight of 446.94 g/mol, XLogP of 4.02, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58197025 is sourced from PubChem (CID 58197025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).