About 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one
4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 58197042) has the molecular formula C22H19F2NO2
and a molecular weight of 367.40 g/mol. Its IUPAC name is 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 58197042 |
| Molecular Formula | C22H19F2NO2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CCC(OC(F)F)CC2)C3)c1 |
| InChI | InChI=1S/C22H19F2NO2/c1-25-17-4-2-3-14(11-17)15-5-6-16-13-22(20(26)19(16)12-15)9-7-18(8-10-22)27-21(23)24/h2-6,11-12,18,21H,7-10,13H2 |
| InChIKey | TVBSOGFURLYQSX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one (CID 58197042) is 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one is [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CCC(OC(F)F)CC2)C3)c1.
What is the InChIKey of 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is TVBSOGFURLYQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2NO2/c1-25-17-4-2-3-14(11-17)15-5-6-16-13-22(20(26)19(16)12-15)9-7-18(8-10-22)27-21(23)24/h2-6,11-12,18,21H,7-10,13H2.
What are the key properties of 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one?
4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 367.40 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(difluoromethoxy)-6-(3-isocyanophenyl)spiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 58197042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).