About methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate
methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 58197056) has the molecular formula C17H22BrNO3
and a molecular weight of 368.27 g/mol. Its IUPAC name is methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| PubChem CID | 58197056 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | COC(=O)C1(N)c2cc(Br)ccc2CC12CCC(OC)CC2 |
| InChI | InChI=1S/C17H22BrNO3/c1-21-13-5-7-16(8-6-13)10-11-3-4-12(18)9-14(11)17(16,19)15(20)22-2/h3-4,9,13H,5-8,10,19H2,1-2H3 |
| InChIKey | KNINSWOWXAZVAU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The IUPAC name of methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (CID 58197056) is methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
What is the SMILES notation for methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The canonical SMILES for methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate is COC(=O)C1(N)c2cc(Br)ccc2CC12CCC(OC)CC2.
What is the InChIKey of methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The InChIKey is KNINSWOWXAZVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrNO3/c1-21-13-5-7-16(8-6-13)10-11-3-4-12(18)9-14(11)17(16,19)15(20)22-2/h3-4,9,13H,5-8,10,19H2,1-2H3.
What are the key properties of methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate has a molecular weight of 368.27 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate is sourced from PubChem (CID 58197056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).