About ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate
ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 58197140) has the molecular formula C18H24BrNO3
and a molecular weight of 382.30 g/mol. Its IUPAC name is ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| PubChem CID | 58197140 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)C1(N)c2cc(Br)ccc2CC12CCC(OC)CC2 |
| InChI | InChI=1S/C18H24BrNO3/c1-3-23-16(21)18(20)15-10-13(19)5-4-12(15)11-17(18)8-6-14(22-2)7-9-17/h4-5,10,14H,3,6-9,11,20H2,1-2H3 |
| InChIKey | HJATYQVCCHYDIE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The IUPAC name of ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (CID 58197140) is ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
What is the SMILES notation for ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The canonical SMILES for ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate is CCOC(=O)C1(N)c2cc(Br)ccc2CC12CCC(OC)CC2.
What is the InChIKey of ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
The InChIKey is HJATYQVCCHYDIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrNO3/c1-3-23-16(21)18(20)15-10-13(19)5-4-12(15)11-17(18)8-6-14(22-2)7-9-17/h4-5,10,14H,3,6-9,11,20H2,1-2H3.
What are the key properties of ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate?
ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate has a molecular weight of 382.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-amino-6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate is sourced from PubChem (CID 58197140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).