About CID 58197177
CID 58197177 (PubChem CID 58197177) has the molecular formula C22H22BrN3O
and a molecular weight of 424.34 g/mol.
Molecular Properties
| Compound Name | CID 58197177 |
| PubChem CID | 58197177 |
| Molecular Formula | C22H22BrN3O |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(Br)ccc1CC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C22H22BrN3O/c1-26-19(27)22(25-20(26)24)18-12-17(23)7-6-16(18)13-21(22)10-8-14-4-2-3-5-15(14)9-11-21/h2-7,12H,8-11,13H2,1H3,(H2,24,25) |
| InChIKey | HJLLROHCPQJCME-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58197177 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58197177?
The IUPAC name of CID 58197177 (CID 58197177) is not available.
What is the SMILES notation for CID 58197177?
The canonical SMILES for CID 58197177 is CN1C(=O)C2(N=C1N)c1cc(Br)ccc1CC21CCc2ccccc2CC1.
What is the InChIKey of CID 58197177?
The InChIKey is HJLLROHCPQJCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22BrN3O/c1-26-19(27)22(25-20(26)24)18-12-17(23)7-6-16(18)13-21(22)10-8-14-4-2-3-5-15(14)9-11-21/h2-7,12H,8-11,13H2,1H3,(H2,24,25).
What are the key properties of CID 58197177?
CID 58197177 has a molecular weight of 424.34 g/mol, XLogP of 3.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58197177 is sourced from PubChem (CID 58197177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).