C20H17BrN2 — CID 58197256
(Z)-6-bromo-N-isocyanospiro[3H-indene-2,7'-5,6,8,9-tetrahydrobenzo[7]annulene]-1-imine (PubChem CID 58197256) has the molecular formula C20H17BrN2 and a molecular weight of 365.27 g/mol. Its IUPAC name is (Z)-6-bromo-N-isocyanospiro[3H-indene-2,7'-5,6,8,9-tetrahydrobenzo[7]annulene]-1-imine.
| Compound Name | (Z)-6-bromo-N-isocyanospiro[3H-indene-2,7'-5,6,8,9-tetrahydrobenzo[7]annulene]-1-imine |
|---|---|
| PubChem CID | 58197256 |
| Molecular Formula | C20H17BrN2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (Z)-6-bromo-N-isocyanospiro[3H-indene-2,7'-5,6,8,9-tetrahydrobenzo[7]annulene]-1-imine |
| SMILES | [C-]#[N+]/N=C1\c2cc(Br)ccc2CC12CCc1ccccc1CC2 |
| InChI | InChI=1S/C20H17BrN2/c1-22-23-19-18-12-17(21)7-6-16(18)13-20(19)10-8-14-4-2-3-5-15(14)9-11-20/h2-7,12H,8-11,13H2/b23-19+ |
| InChIKey | DXSKKSRLONVHEK-FCDQGJHFSA-N |
| XLogP | 5.19 |
| TPSA | 16.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|