C21H29BO4 — CID 58197257
4'-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 58197257) has the molecular formula C21H29BO4 and a molecular weight of 356.27 g/mol. Its IUPAC name is 4'-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[3H-indene-2,1'-cyclohexane]-1-one.
| Compound Name | 4'-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 58197257 |
| Molecular Formula | C21H29BO4 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4'-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | COC1CCC2(CC1)Cc1ccc(B3OC(C)(C)C(C)(C)O3)cc1C2=O |
| InChI | InChI=1S/C21H29BO4/c1-19(2)20(3,4)26-22(25-19)15-7-6-14-13-21(18(23)17(14)12-15)10-8-16(24-5)9-11-21/h6-7,12,16H,8-11,13H2,1-5H3 |
| InChIKey | SCFYMCIXQUWXPZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|