About (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide
(6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (PubChem CID 58197391) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
Molecular Properties
| Compound Name | (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| PubChem CID | 58197391 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| SMILES | CCc1ccc2c(c1)/C(=N\C#N)C1(CCC(OC)CC1)C2 |
| InChI | InChI=1S/C18H22N2O/c1-3-13-4-5-14-11-18(8-6-15(21-2)7-9-18)17(20-12-19)16(14)10-13/h4-5,10,15H,3,6-9,11H2,1-2H3/b20-17+ |
| InChIKey | UAWVFVTUNQRCPG-LVZFUZTISA-N |
| XLogP | 3.65 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The IUPAC name of (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (CID 58197391) is (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
What is the SMILES notation for (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The canonical SMILES for (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is CCc1ccc2c(c1)/C(=N\C#N)C1(CCC(OC)CC1)C2.
What is the InChIKey of (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The InChIKey is UAWVFVTUNQRCPG-LVZFUZTISA-N. The full InChI is InChI=1S/C18H22N2O/c1-3-13-4-5-14-11-18(8-6-15(21-2)7-9-18)17(20-12-19)16(14)10-13/h4-5,10,15H,3,6-9,11H2,1-2H3/b20-17+.
What are the key properties of (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
(6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide has a molecular weight of 282.39 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is sourced from PubChem (CID 58197391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).