C18H17F3O2 — CID 58197494
4'-methoxy-6-(3,3,3-trifluoroprop-1-ynyl)spiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 58197494) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4'-methoxy-6-(3,3,3-trifluoroprop-1-ynyl)spiro[3H-indene-2,1'-cyclohexane]-1-one.
| Compound Name | 4'-methoxy-6-(3,3,3-trifluoroprop-1-ynyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 58197494 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4'-methoxy-6-(3,3,3-trifluoroprop-1-ynyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | COC1CCC2(CC1)Cc1ccc(C#CC(F)(F)F)cc1C2=O |
| InChI | InChI=1S/C18H17F3O2/c1-23-14-5-7-17(8-6-14)11-13-3-2-12(4-9-18(19,20)21)10-15(13)16(17)22/h2-3,10,14H,5-8,11H2,1H3 |
| InChIKey | WDJYCOPQFVHLLY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|